C9H6ClF3O3 — CID 67041821
3-chloro-4-methoxy-5-(trifluoromethyl)benzoic acid (PubChem CID 67041821) has the molecular formula C9H6ClF3O3 and a molecular weight of 254.59 g/mol. Its IUPAC name is 3-chloro-4-methoxy-5-(trifluoromethyl)benzoic acid.
| Compound Name | 3-chloro-4-methoxy-5-(trifluoromethyl)benzoic acid |
|---|---|
| PubChem CID | 67041821 |
| Molecular Formula | C9H6ClF3O3 |
| Molecular Weight | 254.59 g/mol |
| Exact Mass | 254.00 |
| IUPAC Name | 3-chloro-4-methoxy-5-(trifluoromethyl)benzoic acid |
| SMILES | COc1c(Cl)cc(C(=O)O)cc1C(F)(F)F |
| InChI | InChI=1S/C9H6ClF3O3/c1-16-7-5(9(11,12)13)2-4(8(14)15)3-6(7)10/h2-3H,1H3,(H,14,15) |
| InChIKey | JDVPVUPAFTXQDR-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.59 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |