C10H10BrClF3NO2 — CID 171226749
methyl (2R)-2-amino-2-[3-bromo-5-(trifluoromethyl)phenyl]acetate;hydrochloride (PubChem CID 171226749) has the molecular formula C10H10BrClF3NO2 and a molecular weight of 348.55 g/mol. Its IUPAC name is methyl (2R)-2-amino-2-[3-bromo-5-(trifluoromethyl)phenyl]acetate;hydrochloride.
| Compound Name | methyl (2R)-2-amino-2-[3-bromo-5-(trifluoromethyl)phenyl]acetate;hydrochloride |
|---|---|
| PubChem CID | 171226749 |
| Molecular Formula | C10H10BrClF3NO2 |
| Molecular Weight | 348.55 g/mol |
| Exact Mass | 346.95 |
| IUPAC Name | methyl (2R)-2-amino-2-[3-bromo-5-(trifluoromethyl)phenyl]acetate;hydrochloride |
| SMILES | COC(=O)[C@H](N)c1cc(Br)cc(C(F)(F)F)c1.Cl |
| InChI | InChI=1S/C10H9BrF3NO2.ClH/c1-17-9(16)8(15)5-2-6(10(12,13)14)4-7(11)3-5;/h2-4,8H,15H2,1H3;1H/t8-;/m1./s1 |
| InChIKey | QILUVKSTXWQVIQ-DDWIOCJRSA-N |
| XLogP | 3.06 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.55 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |