C11H9BrClF3O2 — CID 83197622
methyl 3-[3-bromo-5-(trifluoromethyl)phenyl]-2-chloropropanoate (PubChem CID 83197622) has the molecular formula C11H9BrClF3O2 and a molecular weight of 345.54 g/mol. Its IUPAC name is methyl 3-[3-bromo-5-(trifluoromethyl)phenyl]-2-chloropropanoate.
| Compound Name | methyl 3-[3-bromo-5-(trifluoromethyl)phenyl]-2-chloropropanoate |
|---|---|
| PubChem CID | 83197622 |
| Molecular Formula | C11H9BrClF3O2 |
| Molecular Weight | 345.54 g/mol |
| Exact Mass | 343.94 |
| IUPAC Name | methyl 3-[3-bromo-5-(trifluoromethyl)phenyl]-2-chloropropanoate |
| SMILES | COC(=O)C(Cl)Cc1cc(Br)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C11H9BrClF3O2/c1-18-10(17)9(13)4-6-2-7(11(14,15)16)5-8(12)3-6/h2-3,5,9H,4H2,1H3 |
| InChIKey | MHXGYDPIFCYMAA-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.54 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|