C11H9Br2F3O — CID 65489655
3-bromo-4-[3-bromo-5-(trifluoromethyl)phenyl]butan-2-one (PubChem CID 65489655) has the molecular formula C11H9Br2F3O and a molecular weight of 373.99 g/mol. Its IUPAC name is 3-bromo-4-[3-bromo-5-(trifluoromethyl)phenyl]butan-2-one.
| Compound Name | 3-bromo-4-[3-bromo-5-(trifluoromethyl)phenyl]butan-2-one |
|---|---|
| PubChem CID | 65489655 |
| Molecular Formula | C11H9Br2F3O |
| Molecular Weight | 373.99 g/mol |
| Exact Mass | 371.90 |
| IUPAC Name | 3-bromo-4-[3-bromo-5-(trifluoromethyl)phenyl]butan-2-one |
| SMILES | CC(=O)C(Br)Cc1cc(Br)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C11H9Br2F3O/c1-6(17)10(13)4-7-2-8(11(14,15)16)5-9(12)3-7/h2-3,5,10H,4H2,1H3 |
| InChIKey | GKGSWQTUYJQUTO-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.99 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|