C13H13Br2F3O — CID 65489263
2-bromo-1-[3-bromo-5-(trifluoromethyl)phenyl]-4-methylpentan-3-one (PubChem CID 65489263) has the molecular formula C13H13Br2F3O and a molecular weight of 402.05 g/mol. Its IUPAC name is 2-bromo-1-[3-bromo-5-(trifluoromethyl)phenyl]-4-methylpentan-3-one.
| Compound Name | 2-bromo-1-[3-bromo-5-(trifluoromethyl)phenyl]-4-methylpentan-3-one |
|---|---|
| PubChem CID | 65489263 |
| Molecular Formula | C13H13Br2F3O |
| Molecular Weight | 402.05 g/mol |
| Exact Mass | 399.93 |
| IUPAC Name | 2-bromo-1-[3-bromo-5-(trifluoromethyl)phenyl]-4-methylpentan-3-one |
| SMILES | CC(C)C(=O)C(Br)Cc1cc(Br)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C13H13Br2F3O/c1-7(2)12(19)11(15)5-8-3-9(13(16,17)18)6-10(14)4-8/h3-4,6-7,11H,5H2,1-2H3 |
| InChIKey | KIYGYGCMKQSCDN-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.05 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|