About methyl 2-chloro-3-[7-[2,6-dichloro-4-(trifluoromethyl)phenoxy]naphthalen-2-yl]propanoate
methyl 2-chloro-3-[7-[2,6-dichloro-4-(trifluoromethyl)phenoxy]naphthalen-2-yl]propanoate (PubChem CID 15051899) has the molecular formula C21H14Cl3F3O3
and a molecular weight of 477.69 g/mol. Its IUPAC name is methyl 2-chloro-3-[7-[2,6-dichloro-4-(trifluoromethyl)phenoxy]naphthalen-2-yl]propanoate.
Molecular Properties
| Compound Name | methyl 2-chloro-3-[7-[2,6-dichloro-4-(trifluoromethyl)phenoxy]naphthalen-2-yl]propanoate |
| PubChem CID | 15051899 |
| Molecular Formula | C21H14Cl3F3O3 |
| Molecular Weight | 477.69 g/mol |
| Exact Mass | 476.00 |
| IUPAC Name | methyl 2-chloro-3-[7-[2,6-dichloro-4-(trifluoromethyl)phenoxy]naphthalen-2-yl]propanoate |
| SMILES | COC(=O)C(Cl)Cc1ccc2ccc(Oc3c(Cl)cc(C(F)(F)F)cc3Cl)cc2c1 |
| InChI | InChI=1S/C21H14Cl3F3O3/c1-29-20(28)18(24)7-11-2-3-12-4-5-15(8-13(12)6-11)30-19-16(22)9-14(10-17(19)23)21(25,26)27/h2-6,8-10,18H,7H2,1H3 |
| InChIKey | QBLWZCCTBGIKFA-UHFFFAOYSA-N |
| XLogP | 7.28 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 477.69 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-chloro-3-[7-[2,6-dichloro-4-(trifluoromethyl)phenoxy]naphthalen-2-yl]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-chloro-3-[7-[2,6-dichloro-4-(trifluoromethyl)phenoxy]naphthalen-2-yl]propanoate?
The IUPAC name of methyl 2-chloro-3-[7-[2,6-dichloro-4-(trifluoromethyl)phenoxy]naphthalen-2-yl]propanoate (CID 15051899) is methyl 2-chloro-3-[7-[2,6-dichloro-4-(trifluoromethyl)phenoxy]naphthalen-2-yl]propanoate.
What is the SMILES notation for methyl 2-chloro-3-[7-[2,6-dichloro-4-(trifluoromethyl)phenoxy]naphthalen-2-yl]propanoate?
The canonical SMILES for methyl 2-chloro-3-[7-[2,6-dichloro-4-(trifluoromethyl)phenoxy]naphthalen-2-yl]propanoate is COC(=O)C(Cl)Cc1ccc2ccc(Oc3c(Cl)cc(C(F)(F)F)cc3Cl)cc2c1.
What is the InChIKey of methyl 2-chloro-3-[7-[2,6-dichloro-4-(trifluoromethyl)phenoxy]naphthalen-2-yl]propanoate?
The InChIKey is QBLWZCCTBGIKFA-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H14Cl3F3O3/c1-29-20(28)18(24)7-11-2-3-12-4-5-15(8-13(12)6-11)30-19-16(22)9-14(10-17(19)23)21(25,26)27/h2-6,8-10,18H,7H2,1H3.
What are the key properties of methyl 2-chloro-3-[7-[2,6-dichloro-4-(trifluoromethyl)phenoxy]naphthalen-2-yl]propanoate?
methyl 2-chloro-3-[7-[2,6-dichloro-4-(trifluoromethyl)phenoxy]naphthalen-2-yl]propanoate has a molecular weight of 477.69 g/mol, XLogP of 7.28, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-chloro-3-[7-[2,6-dichloro-4-(trifluoromethyl)phenoxy]naphthalen-2-yl]propanoate is sourced from PubChem (CID 15051899), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).