C24H20ClF4NO5 — CID 57163334
ethyl 2-[1-[7-[2-chloro-6-fluoro-4-(trifluoromethyl)phenoxy]naphthalen-2-yl]oxyprop-1-en-2-ylamino]oxyacetate (PubChem CID 57163334) has the molecular formula C24H20ClF4NO5 and a molecular weight of 513.87 g/mol. Its IUPAC name is ethyl 2-[1-[7-[2-chloro-6-fluoro-4-(trifluoromethyl)phenoxy]naphthalen-2-yl]oxyprop-1-en-2-ylamino]oxyacetate.
| Compound Name | ethyl 2-[1-[7-[2-chloro-6-fluoro-4-(trifluoromethyl)phenoxy]naphthalen-2-yl]oxyprop-1-en-2-ylamino]oxyacetate |
|---|---|
| PubChem CID | 57163334 |
| Molecular Formula | C24H20ClF4NO5 |
| Molecular Weight | 513.87 g/mol |
| Exact Mass | 513.10 |
| IUPAC Name | ethyl 2-[1-[7-[2-chloro-6-fluoro-4-(trifluoromethyl)phenoxy]naphthalen-2-yl]oxyprop-1-en-2-ylamino]oxyacetate |
| SMILES | CCOC(=O)CONC(C)=COc1ccc2ccc(Oc3c(F)cc(C(F)(F)F)cc3Cl)cc2c1 |
| InChI | InChI=1S/C24H20ClF4NO5/c1-3-32-22(31)13-34-30-14(2)12-33-18-6-4-15-5-7-19(9-16(15)8-18)35-23-20(25)10-17(11-21(23)26)24(27,28)29/h4-12,30H,3,13H2,1-2H3 |
| InChIKey | UQJPGHNOUPWYGH-UHFFFAOYSA-N |
| XLogP | 6.77 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.87 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|