C13H5ClF4N2O5 — CID 15278945
1-chloro-2-(3,4-dinitrophenoxy)-3-fluoro-5-(trifluoromethyl)benzene (PubChem CID 15278945) has the molecular formula C13H5ClF4N2O5 and a molecular weight of 380.64 g/mol. Its IUPAC name is 1-chloro-2-(3,4-dinitrophenoxy)-3-fluoro-5-(trifluoromethyl)benzene.
| Compound Name | 1-chloro-2-(3,4-dinitrophenoxy)-3-fluoro-5-(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 15278945 |
| Molecular Formula | C13H5ClF4N2O5 |
| Molecular Weight | 380.64 g/mol |
| Exact Mass | 379.98 |
| IUPAC Name | 1-chloro-2-(3,4-dinitrophenoxy)-3-fluoro-5-(trifluoromethyl)benzene |
| SMILES | O=[N+]([O-])c1ccc(Oc2c(F)cc(C(F)(F)F)cc2Cl)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C13H5ClF4N2O5/c14-8-3-6(13(16,17)18)4-9(15)12(8)25-7-1-2-10(19(21)22)11(5-7)20(23)24/h1-5H |
| InChIKey | MQWOSYPEXBUFCJ-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 95.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.64 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|