C14H6Cl3F3NO5- — CID 86739293
5-[2,6-dichloro-4-(trifluoromethyl)phenoxy]-2-nitrobenzoic acid chloride (PubChem CID 86739293) has the molecular formula C14H6Cl3F3NO5- and a molecular weight of 431.56 g/mol. Its IUPAC name is 5-[2,6-dichloro-4-(trifluoromethyl)phenoxy]-2-nitrobenzoic acid chloride.
| Compound Name | 5-[2,6-dichloro-4-(trifluoromethyl)phenoxy]-2-nitrobenzoic acid chloride |
|---|---|
| PubChem CID | 86739293 |
| Molecular Formula | C14H6Cl3F3NO5- |
| Molecular Weight | 431.56 g/mol |
| Exact Mass | 429.93 |
| IUPAC Name | 5-[2,6-dichloro-4-(trifluoromethyl)phenoxy]-2-nitrobenzoic acid chloride |
| SMILES | O=C(O)c1cc(Oc2c(Cl)cc(C(F)(F)F)cc2Cl)ccc1[N+](=O)[O-].[Cl-] |
| InChI | InChI=1S/C14H6Cl2F3NO5.ClH/c15-9-3-6(14(17,18)19)4-10(16)12(9)25-7-1-2-11(20(23)24)8(5-7)13(21)22;/h1-5H,(H,21,22);1H/p-1 |
| InChIKey | LGYKDJXBACTMOK-UHFFFAOYSA-M |
| XLogP | 2.41 |
| TPSA | 89.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.56 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|