C15H7ClF3NO6 — CID 20519125
5-[2-chloro-4-(2,2,2-trifluoroacetyl)phenoxy]-2-nitrobenzoic acid (PubChem CID 20519125) has the molecular formula C15H7ClF3NO6 and a molecular weight of 389.67 g/mol. Its IUPAC name is 5-[2-chloro-4-(2,2,2-trifluoroacetyl)phenoxy]-2-nitrobenzoic acid.
| Compound Name | 5-[2-chloro-4-(2,2,2-trifluoroacetyl)phenoxy]-2-nitrobenzoic acid |
|---|---|
| PubChem CID | 20519125 |
| Molecular Formula | C15H7ClF3NO6 |
| Molecular Weight | 389.67 g/mol |
| Exact Mass | 388.99 |
| IUPAC Name | 5-[2-chloro-4-(2,2,2-trifluoroacetyl)phenoxy]-2-nitrobenzoic acid |
| SMILES | O=C(O)c1cc(Oc2ccc(C(=O)C(F)(F)F)cc2Cl)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C15H7ClF3NO6/c16-10-5-7(13(21)15(17,18)19)1-4-12(10)26-8-2-3-11(20(24)25)9(6-8)14(22)23/h1-6H,(H,22,23) |
| InChIKey | LALGCPPRBWJZKR-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 106.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.67 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|