C14H7ClF3NO4 — CID 20519127
1-[3-chloro-4-(4-nitrophenoxy)phenyl]-2,2,2-trifluoroethanone (PubChem CID 20519127) has the molecular formula C14H7ClF3NO4 and a molecular weight of 345.66 g/mol. Its IUPAC name is 1-[3-chloro-4-(4-nitrophenoxy)phenyl]-2,2,2-trifluoroethanone.
| Compound Name | 1-[3-chloro-4-(4-nitrophenoxy)phenyl]-2,2,2-trifluoroethanone |
|---|---|
| PubChem CID | 20519127 |
| Molecular Formula | C14H7ClF3NO4 |
| Molecular Weight | 345.66 g/mol |
| Exact Mass | 345.00 |
| IUPAC Name | 1-[3-chloro-4-(4-nitrophenoxy)phenyl]-2,2,2-trifluoroethanone |
| SMILES | O=C(c1ccc(Oc2ccc([N+](=O)[O-])cc2)c(Cl)c1)C(F)(F)F |
| InChI | InChI=1S/C14H7ClF3NO4/c15-11-7-8(13(20)14(16,17)18)1-6-12(11)23-10-4-2-9(3-5-10)19(21)22/h1-7H |
| InChIKey | CHDZOGMUBZFEAD-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 69.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.66 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|