C11H7BrF6O2 — CID 10384209
methyl 2-[3,5-bis(trifluoromethyl)phenyl]-2-bromoacetate (PubChem CID 10384209) has the molecular formula C11H7BrF6O2 and a molecular weight of 365.07 g/mol. Its IUPAC name is methyl 2-[3,5-bis(trifluoromethyl)phenyl]-2-bromoacetate.
| Compound Name | methyl 2-[3,5-bis(trifluoromethyl)phenyl]-2-bromoacetate |
|---|---|
| PubChem CID | 10384209 |
| Molecular Formula | C11H7BrF6O2 |
| Molecular Weight | 365.07 g/mol |
| Exact Mass | 363.95 |
| IUPAC Name | methyl 2-[3,5-bis(trifluoromethyl)phenyl]-2-bromoacetate |
| SMILES | COC(=O)C(Br)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C11H7BrF6O2/c1-20-9(19)8(12)5-2-6(10(13,14)15)4-7(3-5)11(16,17)18/h2-4,8H,1H3 |
| InChIKey | JFCHFMMVKNEJBE-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.07 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|