C15H19BF6O4 — CID 131697680
(3-hydroxy-2,3-dimethylbutan-2-yl)oxy-[2-methoxy-4,6-bis(trifluoromethyl)phenyl]borinic acid (PubChem CID 131697680) has the molecular formula C15H19BF6O4 and a molecular weight of 388.11 g/mol. Its IUPAC name is (3-hydroxy-2,3-dimethylbutan-2-yl)oxy-[2-methoxy-4,6-bis(trifluoromethyl)phenyl]borinic acid.
| Compound Name | (3-hydroxy-2,3-dimethylbutan-2-yl)oxy-[2-methoxy-4,6-bis(trifluoromethyl)phenyl]borinic acid |
|---|---|
| PubChem CID | 131697680 |
| Molecular Formula | C15H19BF6O4 |
| Molecular Weight | 388.11 g/mol |
| Exact Mass | 388.13 |
| IUPAC Name | (3-hydroxy-2,3-dimethylbutan-2-yl)oxy-[2-methoxy-4,6-bis(trifluoromethyl)phenyl]borinic acid |
| SMILES | COc1cc(C(F)(F)F)cc(C(F)(F)F)c1B(O)OC(C)(C)C(C)(C)O |
| InChI | InChI=1S/C15H19BF6O4/c1-12(2,23)13(3,4)26-16(24)11-9(15(20,21)22)6-8(14(17,18)19)7-10(11)25-5/h6-7,23-24H,1-5H3 |
| InChIKey | SSMVSWICEQHGRM-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.11 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|