C15H25BO4 — CID 75492707
(3-hydroxy-2,3-dimethylbutan-2-yl)oxy-(4-methoxy-2,3-dimethylphenyl)borinic acid (PubChem CID 75492707) has the molecular formula C15H25BO4 and a molecular weight of 280.17 g/mol. Its IUPAC name is (3-hydroxy-2,3-dimethylbutan-2-yl)oxy-(4-methoxy-2,3-dimethylphenyl)borinic acid.
| Compound Name | (3-hydroxy-2,3-dimethylbutan-2-yl)oxy-(4-methoxy-2,3-dimethylphenyl)borinic acid |
|---|---|
| PubChem CID | 75492707 |
| Molecular Formula | C15H25BO4 |
| Molecular Weight | 280.17 g/mol |
| Exact Mass | 280.18 |
| IUPAC Name | (3-hydroxy-2,3-dimethylbutan-2-yl)oxy-(4-methoxy-2,3-dimethylphenyl)borinic acid |
| SMILES | COc1ccc(B(O)OC(C)(C)C(C)(C)O)c(C)c1C |
| InChI | InChI=1S/C15H25BO4/c1-10-11(2)13(19-7)9-8-12(10)16(18)20-15(5,6)14(3,4)17/h8-9,17-18H,1-7H3 |
| InChIKey | QPDGHCNXUKBYCE-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.17 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|