C20H27BO4 — CID 125121221
(3-hydroxy-2,3-dimethylbutan-2-yl)oxy-(5-methyl-2-phenylmethoxyphenyl)borinic acid (PubChem CID 125121221) has the molecular formula C20H27BO4 and a molecular weight of 342.24 g/mol. Its IUPAC name is (3-hydroxy-2,3-dimethylbutan-2-yl)oxy-(5-methyl-2-phenylmethoxyphenyl)borinic acid.
| Compound Name | (3-hydroxy-2,3-dimethylbutan-2-yl)oxy-(5-methyl-2-phenylmethoxyphenyl)borinic acid |
|---|---|
| PubChem CID | 125121221 |
| Molecular Formula | C20H27BO4 |
| Molecular Weight | 342.24 g/mol |
| Exact Mass | 342.20 |
| IUPAC Name | (3-hydroxy-2,3-dimethylbutan-2-yl)oxy-(5-methyl-2-phenylmethoxyphenyl)borinic acid |
| SMILES | Cc1ccc(OCc2ccccc2)c(B(O)OC(C)(C)C(C)(C)O)c1 |
| InChI | InChI=1S/C20H27BO4/c1-15-11-12-18(24-14-16-9-7-6-8-10-16)17(13-15)21(23)25-20(4,5)19(2,3)22/h6-13,22-23H,14H2,1-5H3 |
| InChIKey | VZRFQWKEXPIANS-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.24 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|