C17H20BNO5 — CID 171439716
(2S)-2-amino-3-(3-borono-4-phenylmethoxyphenyl)-2-methylpropanoic acid (PubChem CID 171439716) has the molecular formula C17H20BNO5 and a molecular weight of 329.16 g/mol. Its IUPAC name is (2S)-2-amino-3-(3-borono-4-phenylmethoxyphenyl)-2-methylpropanoic acid.
| Compound Name | (2S)-2-amino-3-(3-borono-4-phenylmethoxyphenyl)-2-methylpropanoic acid |
|---|---|
| PubChem CID | 171439716 |
| Molecular Formula | C17H20BNO5 |
| Molecular Weight | 329.16 g/mol |
| Exact Mass | 329.14 |
| IUPAC Name | (2S)-2-amino-3-(3-borono-4-phenylmethoxyphenyl)-2-methylpropanoic acid |
| SMILES | C[C@](N)(Cc1ccc(OCc2ccccc2)c(B(O)O)c1)C(=O)O |
| InChI | InChI=1S/C17H20BNO5/c1-17(19,16(20)21)10-13-7-8-15(14(9-13)18(22)23)24-11-12-5-3-2-4-6-12/h2-9,22-23H,10-11,19H2,1H3,(H,20,21)/t17-/m0/s1 |
| InChIKey | XAIDMHZAWDHVMB-KRWDZBQOSA-N |
| XLogP | 0.29 |
| TPSA | 113.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.16 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|