C11H16BNO5 — CID 166544630
(2S)-2-amino-3-(4-borono-3-methoxyphenyl)-2-methylpropanoic acid (PubChem CID 166544630) has the molecular formula C11H16BNO5 and a molecular weight of 253.06 g/mol. Its IUPAC name is (2S)-2-amino-3-(4-borono-3-methoxyphenyl)-2-methylpropanoic acid.
| Compound Name | (2S)-2-amino-3-(4-borono-3-methoxyphenyl)-2-methylpropanoic acid |
|---|---|
| PubChem CID | 166544630 |
| Molecular Formula | C11H16BNO5 |
| Molecular Weight | 253.06 g/mol |
| Exact Mass | 253.11 |
| IUPAC Name | (2S)-2-amino-3-(4-borono-3-methoxyphenyl)-2-methylpropanoic acid |
| SMILES | COc1cc(C[C@](C)(N)C(=O)O)ccc1B(O)O |
| InChI | InChI=1S/C11H16BNO5/c1-11(13,10(14)15)6-7-3-4-8(12(16)17)9(5-7)18-2/h3-5,16-17H,6,13H2,1-2H3,(H,14,15)/t11-/m0/s1 |
| InChIKey | HMJDWLLPOSINBE-NSHDSACASA-N |
| XLogP | -1.28 |
| TPSA | 113.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.06 |
| LogP ≤ 5 | -1.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|