C10H12AtNO3 — CID 155761208
[5-(2-amino-2-carboxypropyl)-2-hydroxyphenyl](211At)astatine-211 (PubChem CID 155761208) has the molecular formula C10H12AtNO3 and a molecular weight of 405.20 g/mol. Its IUPAC name is [5-(2-amino-2-carboxypropyl)-2-hydroxyphenyl](211At)astatine-211.
| Compound Name | [5-(2-amino-2-carboxypropyl)-2-hydroxyphenyl](211At)astatine-211 |
|---|---|
| PubChem CID | 155761208 |
| Molecular Formula | C10H12AtNO3 |
| Molecular Weight | 405.20 g/mol |
| Exact Mass | 405.07 |
| IUPAC Name | [5-(2-amino-2-carboxypropyl)-2-hydroxyphenyl](211At)astatine-211 |
| SMILES | CC(N)(Cc1ccc(O)c([211At])c1)C(=O)O |
| InChI | InChI=1S/C10H12AtNO3/c1-10(12,9(14)15)5-6-2-3-8(13)7(11)4-6/h2-4,13H,5,12H2,1H3,(H,14,15)/i11+1 |
| InChIKey | ZNCWJRLGKDLIGY-KHWBWMQUSA-N |
| XLogP | -0.09 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.20 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |