C10H12FNO3 — CID 176816292
2-amino-3-(3-(18F)fluoro-4-hydroxyphenyl)-2-methylpropanoic acid (PubChem CID 176816292) has the molecular formula C10H12FNO3 and a molecular weight of 212.21 g/mol. Its IUPAC name is 2-amino-3-(3-(18F)fluoro-4-hydroxyphenyl)-2-methylpropanoic acid.
| Compound Name | 2-amino-3-(3-(18F)fluoro-4-hydroxyphenyl)-2-methylpropanoic acid |
|---|---|
| PubChem CID | 176816292 |
| Molecular Formula | C10H12FNO3 |
| Molecular Weight | 212.21 g/mol |
| Exact Mass | 212.08 |
| IUPAC Name | 2-amino-3-(3-(18F)fluoro-4-hydroxyphenyl)-2-methylpropanoic acid |
| SMILES | CC(N)(Cc1ccc(O)c([18F])c1)C(=O)O |
| InChI | InChI=1S/C10H12FNO3/c1-10(12,9(14)15)5-6-2-3-8(13)7(11)4-6/h2-4,13H,5,12H2,1H3,(H,14,15)/i11-1 |
| InChIKey | STUMEFJLAPRRME-KXMUYVCJSA-N |
| XLogP | 0.88 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.21 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |