C10H14BNO5 — CID 170692621
(2S)-2-amino-3-(3-borono-4-hydroxyphenyl)-2-methylpropanoic acid (PubChem CID 170692621) has the molecular formula C10H14BNO5 and a molecular weight of 239.04 g/mol. Its IUPAC name is (2S)-2-amino-3-(3-borono-4-hydroxyphenyl)-2-methylpropanoic acid.
| Compound Name | (2S)-2-amino-3-(3-borono-4-hydroxyphenyl)-2-methylpropanoic acid |
|---|---|
| PubChem CID | 170692621 |
| Molecular Formula | C10H14BNO5 |
| Molecular Weight | 239.04 g/mol |
| Exact Mass | 239.10 |
| IUPAC Name | (2S)-2-amino-3-(3-borono-4-hydroxyphenyl)-2-methylpropanoic acid |
| SMILES | C[C@](N)(Cc1ccc(O)c(B(O)O)c1)C(=O)O |
| InChI | InChI=1S/C10H14BNO5/c1-10(12,9(14)15)5-6-2-3-8(13)7(4-6)11(16)17/h2-4,13,16-17H,5,12H2,1H3,(H,14,15)/t10-/m0/s1 |
| InChIKey | ZWXARWFSZUCLDC-JTQLQIEISA-N |
| XLogP | -1.58 |
| TPSA | 124.01 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.04 |
| LogP ≤ 5 | -1.58 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|