C10H15NO4 — CID 2729001
2-amino-3-(3-hydroxyphenyl)-2-methylpropanoic acid;hydrate (PubChem CID 2729001) has the molecular formula C10H15NO4 and a molecular weight of 213.23 g/mol. Its IUPAC name is 2-amino-3-(3-hydroxyphenyl)-2-methylpropanoic acid;hydrate.
| Compound Name | 2-amino-3-(3-hydroxyphenyl)-2-methylpropanoic acid;hydrate |
|---|---|
| PubChem CID | 2729001 |
| Molecular Formula | C10H15NO4 |
| Molecular Weight | 213.23 g/mol |
| Exact Mass | 213.10 |
| IUPAC Name | 2-amino-3-(3-hydroxyphenyl)-2-methylpropanoic acid;hydrate |
| SMILES | CC(N)(Cc1cccc(O)c1)C(=O)O.O |
| InChI | InChI=1S/C10H13NO3.H2O/c1-10(11,9(13)14)6-7-3-2-4-8(12)5-7;/h2-5,12H,6,11H2,1H3,(H,13,14);1H2 |
| InChIKey | AXPIQPAXHALJBL-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 115.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.23 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |