C12H14O3 — CID 102639732
2-[(3-hydroxyphenyl)methyl]-2-methylbut-3-enoic acid (PubChem CID 102639732) has the molecular formula C12H14O3 and a molecular weight of 206.24 g/mol. Its IUPAC name is 2-[(3-hydroxyphenyl)methyl]-2-methylbut-3-enoic acid.
| Compound Name | 2-[(3-hydroxyphenyl)methyl]-2-methylbut-3-enoic acid |
|---|---|
| PubChem CID | 102639732 |
| Molecular Formula | C12H14O3 |
| Molecular Weight | 206.24 g/mol |
| Exact Mass | 206.09 |
| IUPAC Name | 2-[(3-hydroxyphenyl)methyl]-2-methylbut-3-enoic acid |
| SMILES | C=CC(C)(Cc1cccc(O)c1)C(=O)O |
| InChI | InChI=1S/C12H14O3/c1-3-12(2,11(14)15)8-9-5-4-6-10(13)7-9/h3-7,13H,1,8H2,2H3,(H,14,15) |
| InChIKey | HFNARNVJBYQKNB-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.24 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|