About 3-(3-hydroxyphenyl)-2,2-dimethylpropane-1-sulfonyl fluoride
3-(3-hydroxyphenyl)-2,2-dimethylpropane-1-sulfonyl fluoride (PubChem CID 115045835) has the molecular formula C11H15FO3S
and a molecular weight of 246.30 g/mol. Its IUPAC name is 3-(3-hydroxyphenyl)-2,2-dimethylpropane-1-sulfonyl fluoride.
Analyze 3-(3-hydroxyphenyl)-2,2-dimethylpropane-1-sulfonyl fluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3-hydroxyphenyl)-2,2-dimethylpropane-1-sulfonyl fluoride?
The IUPAC name of 3-(3-hydroxyphenyl)-2,2-dimethylpropane-1-sulfonyl fluoride (CID 115045835) is 3-(3-hydroxyphenyl)-2,2-dimethylpropane-1-sulfonyl fluoride.
What is the SMILES notation for 3-(3-hydroxyphenyl)-2,2-dimethylpropane-1-sulfonyl fluoride?
The canonical SMILES for 3-(3-hydroxyphenyl)-2,2-dimethylpropane-1-sulfonyl fluoride is CC(C)(Cc1cccc(O)c1)CS(=O)(=O)F.
What is the InChIKey of 3-(3-hydroxyphenyl)-2,2-dimethylpropane-1-sulfonyl fluoride?
The InChIKey is CFEGBZYLIDXJBC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15FO3S/c1-11(2,8-16(12,14)15)7-9-4-3-5-10(13)6-9/h3-6,13H,7-8H2,1-2H3.
What are the key properties of 3-(3-hydroxyphenyl)-2,2-dimethylpropane-1-sulfonyl fluoride?
3-(3-hydroxyphenyl)-2,2-dimethylpropane-1-sulfonyl fluoride has a molecular weight of 246.30 g/mol, XLogP of 2.26, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3-hydroxyphenyl)-2,2-dimethylpropane-1-sulfonyl fluoride is sourced from PubChem (CID 115045835), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).