About 3-(3-methoxyphenyl)-2,2-dimethylpropane-1-sulfonyl fluoride
3-(3-methoxyphenyl)-2,2-dimethylpropane-1-sulfonyl fluoride (PubChem CID 115048618) has the molecular formula C12H17FO3S
and a molecular weight of 260.33 g/mol. Its IUPAC name is 3-(3-methoxyphenyl)-2,2-dimethylpropane-1-sulfonyl fluoride.
Analyze 3-(3-methoxyphenyl)-2,2-dimethylpropane-1-sulfonyl fluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3-methoxyphenyl)-2,2-dimethylpropane-1-sulfonyl fluoride?
The IUPAC name of 3-(3-methoxyphenyl)-2,2-dimethylpropane-1-sulfonyl fluoride (CID 115048618) is 3-(3-methoxyphenyl)-2,2-dimethylpropane-1-sulfonyl fluoride.
What is the SMILES notation for 3-(3-methoxyphenyl)-2,2-dimethylpropane-1-sulfonyl fluoride?
The canonical SMILES for 3-(3-methoxyphenyl)-2,2-dimethylpropane-1-sulfonyl fluoride is COc1cccc(CC(C)(C)CS(=O)(=O)F)c1.
What is the InChIKey of 3-(3-methoxyphenyl)-2,2-dimethylpropane-1-sulfonyl fluoride?
The InChIKey is YWSLCFWOEVRKSN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17FO3S/c1-12(2,9-17(13,14)15)8-10-5-4-6-11(7-10)16-3/h4-7H,8-9H2,1-3H3.
What are the key properties of 3-(3-methoxyphenyl)-2,2-dimethylpropane-1-sulfonyl fluoride?
3-(3-methoxyphenyl)-2,2-dimethylpropane-1-sulfonyl fluoride has a molecular weight of 260.33 g/mol, XLogP of 2.56, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3-methoxyphenyl)-2,2-dimethylpropane-1-sulfonyl fluoride is sourced from PubChem (CID 115048618), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).