C14H18O — CID 11816526
1-[3-(2,2-dimethylbut-3-enyl)phenyl]ethanone (PubChem CID 11816526) has the molecular formula C14H18O and a molecular weight of 202.30 g/mol. Its IUPAC name is 1-[3-(2,2-dimethylbut-3-enyl)phenyl]ethanone.
| Compound Name | 1-[3-(2,2-dimethylbut-3-enyl)phenyl]ethanone |
|---|---|
| PubChem CID | 11816526 |
| Molecular Formula | C14H18O |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.14 |
| IUPAC Name | 1-[3-(2,2-dimethylbut-3-enyl)phenyl]ethanone |
| SMILES | C=CC(C)(C)Cc1cccc(C(C)=O)c1 |
| InChI | InChI=1S/C14H18O/c1-5-14(3,4)10-12-7-6-8-13(9-12)11(2)15/h5-9H,1,10H2,2-4H3 |
| InChIKey | JXZURCDKPFSHPX-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|