C11H16N2O5S — CID 10446808
(2S)-2-amino-3-[3-hydroxy-4-(methanesulfonamido)phenyl]-2-methylpropanoic acid (PubChem CID 10446808) has the molecular formula C11H16N2O5S and a molecular weight of 288.32 g/mol. Its IUPAC name is (2S)-2-amino-3-[3-hydroxy-4-(methanesulfonamido)phenyl]-2-methylpropanoic acid.
| Compound Name | (2S)-2-amino-3-[3-hydroxy-4-(methanesulfonamido)phenyl]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 10446808 |
| Molecular Formula | C11H16N2O5S |
| Molecular Weight | 288.32 g/mol |
| Exact Mass | 288.08 |
| IUPAC Name | (2S)-2-amino-3-[3-hydroxy-4-(methanesulfonamido)phenyl]-2-methylpropanoic acid |
| SMILES | C[C@](N)(Cc1ccc(NS(C)(=O)=O)c(O)c1)C(=O)O |
| InChI | InChI=1S/C11H16N2O5S/c1-11(12,10(15)16)6-7-3-4-8(9(14)5-7)13-19(2,17)18/h3-5,13-14H,6,12H2,1-2H3,(H,15,16)/t11-/m0/s1 |
| InChIKey | LOOGGOHHFPUGQV-NSHDSACASA-N |
| XLogP | 0.11 |
| TPSA | 129.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.32 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|