C13H19BO4 — CID 87381434
(2-formylphenyl)-(3-hydroxy-2,3-dimethylbutan-2-yl)oxyborinic acid (PubChem CID 87381434) has the molecular formula C13H19BO4 and a molecular weight of 250.10 g/mol. Its IUPAC name is (2-formylphenyl)-(3-hydroxy-2,3-dimethylbutan-2-yl)oxyborinic acid.
| Compound Name | (2-formylphenyl)-(3-hydroxy-2,3-dimethylbutan-2-yl)oxyborinic acid |
|---|---|
| PubChem CID | 87381434 |
| Molecular Formula | C13H19BO4 |
| Molecular Weight | 250.10 g/mol |
| Exact Mass | 250.14 |
| IUPAC Name | (2-formylphenyl)-(3-hydroxy-2,3-dimethylbutan-2-yl)oxyborinic acid |
| SMILES | CC(C)(O)C(C)(C)OB(O)c1ccccc1C=O |
| InChI | InChI=1S/C13H19BO4/c1-12(2,16)13(3,4)18-14(17)11-8-6-5-7-10(11)9-15/h5-9,16-17H,1-4H3 |
| InChIKey | RCUSGQHUBWIWCZ-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.10 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|