C20H34B2O6 — CID 175647576
[2-bis[(3-hydroxy-2,3-dimethylbutan-2-yl)oxy]boranyl-2-phenylethenyl]boronic acid (PubChem CID 175647576) has the molecular formula C20H34B2O6 and a molecular weight of 392.11 g/mol. Its IUPAC name is [2-bis[(3-hydroxy-2,3-dimethylbutan-2-yl)oxy]boranyl-2-phenylethenyl]boronic acid.
| Compound Name | [2-bis[(3-hydroxy-2,3-dimethylbutan-2-yl)oxy]boranyl-2-phenylethenyl]boronic acid |
|---|---|
| PubChem CID | 175647576 |
| Molecular Formula | C20H34B2O6 |
| Molecular Weight | 392.11 g/mol |
| Exact Mass | 392.25 |
| IUPAC Name | [2-bis[(3-hydroxy-2,3-dimethylbutan-2-yl)oxy]boranyl-2-phenylethenyl]boronic acid |
| SMILES | CC(C)(O)C(C)(C)OB(OC(C)(C)C(C)(C)O)C(=CB(O)O)c1ccccc1 |
| InChI | InChI=1S/C20H34B2O6/c1-17(2,23)19(5,6)27-22(28-20(7,8)18(3,4)24)16(14-21(25)26)15-12-10-9-11-13-15/h9-14,23-26H,1-8H3 |
| InChIKey | ACMOMAKBEAJYKF-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 99.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.11 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|