C19H21BF2O4 — CID 131697654
[2-(2,5-difluoro-4-formylphenyl)phenyl]-(3-hydroxy-2,3-dimethylbutan-2-yl)oxyborinic acid (PubChem CID 131697654) has the molecular formula C19H21BF2O4 and a molecular weight of 362.18 g/mol. Its IUPAC name is [2-(2,5-difluoro-4-formylphenyl)phenyl]-(3-hydroxy-2,3-dimethylbutan-2-yl)oxyborinic acid.
| Compound Name | [2-(2,5-difluoro-4-formylphenyl)phenyl]-(3-hydroxy-2,3-dimethylbutan-2-yl)oxyborinic acid |
|---|---|
| PubChem CID | 131697654 |
| Molecular Formula | C19H21BF2O4 |
| Molecular Weight | 362.18 g/mol |
| Exact Mass | 362.15 |
| IUPAC Name | [2-(2,5-difluoro-4-formylphenyl)phenyl]-(3-hydroxy-2,3-dimethylbutan-2-yl)oxyborinic acid |
| SMILES | CC(C)(O)C(C)(C)OB(O)c1ccccc1-c1cc(F)c(C=O)cc1F |
| InChI | InChI=1S/C19H21BF2O4/c1-18(2,24)19(3,4)26-20(25)15-8-6-5-7-13(15)14-10-16(21)12(11-23)9-17(14)22/h5-11,24-25H,1-4H3 |
| InChIKey | PXMDGTMKEBBLGO-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.18 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|