C15H20BNO3 — CID 51358263
(3-hydroxy-2,3-dimethylbutan-2-yl)oxy-quinolin-8-ylborinic acid (PubChem CID 51358263) has the molecular formula C15H20BNO3 and a molecular weight of 273.14 g/mol. Its IUPAC name is (3-hydroxy-2,3-dimethylbutan-2-yl)oxy-quinolin-8-ylborinic acid.
| Compound Name | (3-hydroxy-2,3-dimethylbutan-2-yl)oxy-quinolin-8-ylborinic acid |
|---|---|
| PubChem CID | 51358263 |
| Molecular Formula | C15H20BNO3 |
| Molecular Weight | 273.14 g/mol |
| Exact Mass | 273.15 |
| IUPAC Name | (3-hydroxy-2,3-dimethylbutan-2-yl)oxy-quinolin-8-ylborinic acid |
| SMILES | CC(C)(O)C(C)(C)OB(O)c1cccc2cccnc12 |
| InChI | InChI=1S/C15H20BNO3/c1-14(2,18)15(3,4)20-16(19)12-9-5-7-11-8-6-10-17-13(11)12/h5-10,18-19H,1-4H3 |
| InChIKey | PGMCGEPUYPXWCU-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 62.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.14 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|