C13H19BN2O3 — CID 66927594
(3-hydroxy-2,3-dimethylbutan-2-yl)oxy-(1H-pyrrolo[2,3-b]pyridin-4-yl)borinic acid (PubChem CID 66927594) has the molecular formula C13H19BN2O3 and a molecular weight of 262.12 g/mol. Its IUPAC name is (3-hydroxy-2,3-dimethylbutan-2-yl)oxy-(1H-pyrrolo[2,3-b]pyridin-4-yl)borinic acid.
| Compound Name | (3-hydroxy-2,3-dimethylbutan-2-yl)oxy-(1H-pyrrolo[2,3-b]pyridin-4-yl)borinic acid |
|---|---|
| PubChem CID | 66927594 |
| Molecular Formula | C13H19BN2O3 |
| Molecular Weight | 262.12 g/mol |
| Exact Mass | 262.15 |
| IUPAC Name | (3-hydroxy-2,3-dimethylbutan-2-yl)oxy-(1H-pyrrolo[2,3-b]pyridin-4-yl)borinic acid |
| SMILES | CC(C)(O)C(C)(C)OB(O)c1ccnc2[nH]ccc12 |
| InChI | InChI=1S/C13H19BN2O3/c1-12(2,17)13(3,4)19-14(18)10-6-8-16-11-9(10)5-7-15-11/h5-8,17-18H,1-4H3,(H,15,16) |
| InChIKey | IKVWGHLPRVREGC-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 78.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.12 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|