C13H18BF3O4 — CID 71307428
(3-hydroxy-2,3-dimethylbutan-2-yl)oxy-[4-(trifluoromethoxy)phenyl]borinic acid (PubChem CID 71307428) has the molecular formula C13H18BF3O4 and a molecular weight of 306.09 g/mol. Its IUPAC name is (3-hydroxy-2,3-dimethylbutan-2-yl)oxy-[4-(trifluoromethoxy)phenyl]borinic acid.
| Compound Name | (3-hydroxy-2,3-dimethylbutan-2-yl)oxy-[4-(trifluoromethoxy)phenyl]borinic acid |
|---|---|
| PubChem CID | 71307428 |
| Molecular Formula | C13H18BF3O4 |
| Molecular Weight | 306.09 g/mol |
| Exact Mass | 306.13 |
| IUPAC Name | (3-hydroxy-2,3-dimethylbutan-2-yl)oxy-[4-(trifluoromethoxy)phenyl]borinic acid |
| SMILES | CC(C)(O)C(C)(C)OB(O)c1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C13H18BF3O4/c1-11(2,18)12(3,4)21-14(19)9-5-7-10(8-6-9)20-13(15,16)17/h5-8,18-19H,1-4H3 |
| InChIKey | GUAJQAVJZIOMSN-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.09 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|