C12H21BClNO3 — CID 121000604
(4-aminophenyl)-(3-hydroxy-2,3-dimethylbutan-2-yl)oxyborinic acid;hydrochloride (PubChem CID 121000604) has the molecular formula C12H21BClNO3 and a molecular weight of 273.57 g/mol. Its IUPAC name is (4-aminophenyl)-(3-hydroxy-2,3-dimethylbutan-2-yl)oxyborinic acid;hydrochloride.
| Compound Name | (4-aminophenyl)-(3-hydroxy-2,3-dimethylbutan-2-yl)oxyborinic acid;hydrochloride |
|---|---|
| PubChem CID | 121000604 |
| Molecular Formula | C12H21BClNO3 |
| Molecular Weight | 273.57 g/mol |
| Exact Mass | 273.13 |
| IUPAC Name | (4-aminophenyl)-(3-hydroxy-2,3-dimethylbutan-2-yl)oxyborinic acid;hydrochloride |
| SMILES | CC(C)(O)C(C)(C)OB(O)c1ccc(N)cc1.Cl |
| InChI | InChI=1S/C12H20BNO3.ClH/c1-11(2,15)12(3,4)17-13(16)9-5-7-10(14)8-6-9;/h5-8,15-16H,14H2,1-4H3;1H |
| InChIKey | CDOOCXDNTVHSFW-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.57 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|