C13H17F3O2 — CID 175409271
2,3-dimethyl-3-[4-(trifluoromethyl)phenoxy]butan-2-ol (PubChem CID 175409271) has the molecular formula C13H17F3O2 and a molecular weight of 262.27 g/mol. Its IUPAC name is 2,3-dimethyl-3-[4-(trifluoromethyl)phenoxy]butan-2-ol.
| Compound Name | 2,3-dimethyl-3-[4-(trifluoromethyl)phenoxy]butan-2-ol |
|---|---|
| PubChem CID | 175409271 |
| Molecular Formula | C13H17F3O2 |
| Molecular Weight | 262.27 g/mol |
| Exact Mass | 262.12 |
| IUPAC Name | 2,3-dimethyl-3-[4-(trifluoromethyl)phenoxy]butan-2-ol |
| SMILES | CC(C)(O)C(C)(C)Oc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C13H17F3O2/c1-11(2,17)12(3,4)18-10-7-5-9(6-8-10)13(14,15)16/h5-8,17H,1-4H3 |
| InChIKey | FFOSCVRUANMFOI-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.27 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |