C9H5F5O2 — CID 174144064
2,2-difluoro-2-[4-(trifluoromethyl)phenoxy]acetaldehyde (PubChem CID 174144064) has the molecular formula C9H5F5O2 and a molecular weight of 240.13 g/mol. Its IUPAC name is 2,2-difluoro-2-[4-(trifluoromethyl)phenoxy]acetaldehyde.
| Compound Name | 2,2-difluoro-2-[4-(trifluoromethyl)phenoxy]acetaldehyde |
|---|---|
| PubChem CID | 174144064 |
| Molecular Formula | C9H5F5O2 |
| Molecular Weight | 240.13 g/mol |
| Exact Mass | 240.02 |
| IUPAC Name | 2,2-difluoro-2-[4-(trifluoromethyl)phenoxy]acetaldehyde |
| SMILES | O=CC(F)(F)Oc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C9H5F5O2/c10-8(11,5-15)16-7-3-1-6(2-4-7)9(12,13)14/h1-5H |
| InChIKey | SYNXURVVSRCULH-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.13 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|