C9H7F5O — CID 59933429
1-(1,1-difluoroethoxy)-4-(trifluoromethyl)benzene (PubChem CID 59933429) has the molecular formula C9H7F5O and a molecular weight of 226.14 g/mol. Its IUPAC name is 1-(1,1-difluoroethoxy)-4-(trifluoromethyl)benzene.
| Compound Name | 1-(1,1-difluoroethoxy)-4-(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 59933429 |
| Molecular Formula | C9H7F5O |
| Molecular Weight | 226.14 g/mol |
| Exact Mass | 226.04 |
| IUPAC Name | 1-(1,1-difluoroethoxy)-4-(trifluoromethyl)benzene |
| SMILES | CC(F)(F)Oc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C9H7F5O/c1-8(10,11)15-7-4-2-6(3-5-7)9(12,13)14/h2-5H,1H3 |
| InChIKey | LZXGHECGDBVFON-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.14 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |