C15H24O2 — CID 175005292
2,3-dimethyl-3-(4-propan-2-ylphenoxy)butan-2-ol (PubChem CID 175005292) has the molecular formula C15H24O2 and a molecular weight of 236.35 g/mol. Its IUPAC name is 2,3-dimethyl-3-(4-propan-2-ylphenoxy)butan-2-ol.
| Compound Name | 2,3-dimethyl-3-(4-propan-2-ylphenoxy)butan-2-ol |
|---|---|
| PubChem CID | 175005292 |
| Molecular Formula | C15H24O2 |
| Molecular Weight | 236.35 g/mol |
| Exact Mass | 236.18 |
| IUPAC Name | 2,3-dimethyl-3-(4-propan-2-ylphenoxy)butan-2-ol |
| SMILES | CC(C)c1ccc(OC(C)(C)C(C)(C)O)cc1 |
| InChI | InChI=1S/C15H24O2/c1-11(2)12-7-9-13(10-8-12)17-15(5,6)14(3,4)16/h7-11,16H,1-6H3 |
| InChIKey | CQYMKJSXSDHUPN-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.35 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |