C13H23BO6 — CID 174970272
boric acid;3-[4-(hydroxymethyl)phenoxy]-2,3-dimethylbutan-2-ol (PubChem CID 174970272) has the molecular formula C13H23BO6 and a molecular weight of 286.13 g/mol. Its IUPAC name is boric acid;3-[4-(hydroxymethyl)phenoxy]-2,3-dimethylbutan-2-ol.
| Compound Name | boric acid;3-[4-(hydroxymethyl)phenoxy]-2,3-dimethylbutan-2-ol |
|---|---|
| PubChem CID | 174970272 |
| Molecular Formula | C13H23BO6 |
| Molecular Weight | 286.13 g/mol |
| Exact Mass | 286.16 |
| IUPAC Name | boric acid;3-[4-(hydroxymethyl)phenoxy]-2,3-dimethylbutan-2-ol |
| SMILES | CC(C)(O)C(C)(C)Oc1ccc(CO)cc1.OB(O)O |
| InChI | InChI=1S/C13H20O3.BH3O3/c1-12(2,15)13(3,4)16-11-7-5-10(9-14)6-8-11;2-1(3)4/h5-8,14-15H,9H2,1-4H3;2-4H |
| InChIKey | KWKSVMBJOPAXOB-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 110.38 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.13 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|