C14H15F3O2 — CID 69465122
2-methyl-6-[4-(trifluoromethoxy)phenyl]hex-5-yn-2-ol (PubChem CID 69465122) has the molecular formula C14H15F3O2 and a molecular weight of 272.27 g/mol. Its IUPAC name is 2-methyl-6-[4-(trifluoromethoxy)phenyl]hex-5-yn-2-ol.
| Compound Name | 2-methyl-6-[4-(trifluoromethoxy)phenyl]hex-5-yn-2-ol |
|---|---|
| PubChem CID | 69465122 |
| Molecular Formula | C14H15F3O2 |
| Molecular Weight | 272.27 g/mol |
| Exact Mass | 272.10 |
| IUPAC Name | 2-methyl-6-[4-(trifluoromethoxy)phenyl]hex-5-yn-2-ol |
| SMILES | CC(C)(O)CCC#Cc1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C14H15F3O2/c1-13(2,18)10-4-3-5-11-6-8-12(9-7-11)19-14(15,16)17/h6-9,18H,4,10H2,1-2H3 |
| InChIKey | YIXNAZUSLUTAGP-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.27 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|