C19H13F3O2 — CID 144581648
1-methoxy-4-[5-[4-(trifluoromethoxy)phenyl]penta-1,4-diynyl]benzene (PubChem CID 144581648) has the molecular formula C19H13F3O2 and a molecular weight of 330.31 g/mol. Its IUPAC name is 1-methoxy-4-[5-[4-(trifluoromethoxy)phenyl]penta-1,4-diynyl]benzene.
| Compound Name | 1-methoxy-4-[5-[4-(trifluoromethoxy)phenyl]penta-1,4-diynyl]benzene |
|---|---|
| PubChem CID | 144581648 |
| Molecular Formula | C19H13F3O2 |
| Molecular Weight | 330.31 g/mol |
| Exact Mass | 330.09 |
| IUPAC Name | 1-methoxy-4-[5-[4-(trifluoromethoxy)phenyl]penta-1,4-diynyl]benzene |
| SMILES | COc1ccc(C#CCC#Cc2ccc(OC(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C19H13F3O2/c1-23-17-11-7-15(8-12-17)5-3-2-4-6-16-9-13-18(14-10-16)24-19(20,21)22/h7-14H,2H2,1H3 |
| InChIKey | WMJOCTYEPPKEGX-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.31 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|