C9H7BrF4O2 — CID 155895177
1-(1-bromo-1,2,2,2-tetrafluoroethoxy)-4-methoxybenzene (PubChem CID 155895177) has the molecular formula C9H7BrF4O2 and a molecular weight of 303.05 g/mol. Its IUPAC name is 1-(1-bromo-1,2,2,2-tetrafluoroethoxy)-4-methoxybenzene.
| Compound Name | 1-(1-bromo-1,2,2,2-tetrafluoroethoxy)-4-methoxybenzene |
|---|---|
| PubChem CID | 155895177 |
| Molecular Formula | C9H7BrF4O2 |
| Molecular Weight | 303.05 g/mol |
| Exact Mass | 301.96 |
| IUPAC Name | 1-(1-bromo-1,2,2,2-tetrafluoroethoxy)-4-methoxybenzene |
| SMILES | COc1ccc(OC(F)(Br)C(F)(F)F)cc1 |
| InChI | InChI=1S/C9H7BrF4O2/c1-15-6-2-4-7(5-3-6)16-8(10,11)9(12,13)14/h2-5H,1H3 |
| InChIKey | LBGRBWIWGGYQCE-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.05 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|