C10H9Br2F3O — CID 154711398
1-(2,3-dibromo-1,1,1-trifluoropropan-2-yl)-4-methoxybenzene (PubChem CID 154711398) has the molecular formula C10H9Br2F3O and a molecular weight of 361.98 g/mol. Its IUPAC name is 1-(2,3-dibromo-1,1,1-trifluoropropan-2-yl)-4-methoxybenzene.
| Compound Name | 1-(2,3-dibromo-1,1,1-trifluoropropan-2-yl)-4-methoxybenzene |
|---|---|
| PubChem CID | 154711398 |
| Molecular Formula | C10H9Br2F3O |
| Molecular Weight | 361.98 g/mol |
| Exact Mass | 359.90 |
| IUPAC Name | 1-(2,3-dibromo-1,1,1-trifluoropropan-2-yl)-4-methoxybenzene |
| SMILES | COc1ccc(C(Br)(CBr)C(F)(F)F)cc1 |
| InChI | InChI=1S/C10H9Br2F3O/c1-16-8-4-2-7(3-5-8)9(12,6-11)10(13,14)15/h2-5H,6H2,1H3 |
| InChIKey | OLUZGYGHXQLLOF-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.98 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|