C10H12F3NO — CID 115257725
4-methoxy-N-methyl-N-(2,2,2-trifluoroethyl)aniline (PubChem CID 115257725) has the molecular formula C10H12F3NO and a molecular weight of 219.21 g/mol. Its IUPAC name is 4-methoxy-N-methyl-N-(2,2,2-trifluoroethyl)aniline.
| Compound Name | 4-methoxy-N-methyl-N-(2,2,2-trifluoroethyl)aniline |
|---|---|
| PubChem CID | 115257725 |
| Molecular Formula | C10H12F3NO |
| Molecular Weight | 219.21 g/mol |
| Exact Mass | 219.09 |
| IUPAC Name | 4-methoxy-N-methyl-N-(2,2,2-trifluoroethyl)aniline |
| SMILES | COc1ccc(N(C)CC(F)(F)F)cc1 |
| InChI | InChI=1S/C10H12F3NO/c1-14(7-10(11,12)13)8-3-5-9(15-2)6-4-8/h3-6H,7H2,1-2H3 |
| InChIKey | GYXANITYJHLYIU-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.21 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|