C27H28F6N2O2 — CID 100990184
4-[methoxy-(3-methoxyphenyl)-[4-[methyl(2,2,2-trifluoroethyl)amino]phenyl]methyl]-N-methyl-N-(2,2,2-trifluoroethyl)aniline (PubChem CID 100990184) has the molecular formula C27H28F6N2O2 and a molecular weight of 526.52 g/mol. Its IUPAC name is 4-[methoxy-(3-methoxyphenyl)-[4-[methyl(2,2,2-trifluoroethyl)amino]phenyl]methyl]-N-methyl-N-(2,2,2-trifluoroethyl)aniline.
| Compound Name | 4-[methoxy-(3-methoxyphenyl)-[4-[methyl(2,2,2-trifluoroethyl)amino]phenyl]methyl]-N-methyl-N-(2,2,2-trifluoroethyl)aniline |
|---|---|
| PubChem CID | 100990184 |
| Molecular Formula | C27H28F6N2O2 |
| Molecular Weight | 526.52 g/mol |
| Exact Mass | 526.21 |
| IUPAC Name | 4-[methoxy-(3-methoxyphenyl)-[4-[methyl(2,2,2-trifluoroethyl)amino]phenyl]methyl]-N-methyl-N-(2,2,2-trifluoroethyl)aniline |
| SMILES | COc1cccc(C(OC)(c2ccc(N(C)CC(F)(F)F)cc2)c2ccc(N(C)CC(F)(F)F)cc2)c1 |
| InChI | InChI=1S/C27H28F6N2O2/c1-34(17-25(28,29)30)22-12-8-19(9-13-22)27(37-4,21-6-5-7-24(16-21)36-3)20-10-14-23(15-11-20)35(2)18-26(31,32)33/h5-16H,17-18H2,1-4H3 |
| InChIKey | BRXFWVMUUALSKL-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.52 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|