C26H26F6N2 — CID 100990166
N-methyl-4-[(4-methylphenyl)-[4-[methyl(2,2,2-trifluoroethyl)amino]phenyl]methyl]-N-(2,2,2-trifluoroethyl)aniline (PubChem CID 100990166) has the molecular formula C26H26F6N2 and a molecular weight of 480.50 g/mol. Its IUPAC name is N-methyl-4-[(4-methylphenyl)-[4-[methyl(2,2,2-trifluoroethyl)amino]phenyl]methyl]-N-(2,2,2-trifluoroethyl)aniline.
| Compound Name | N-methyl-4-[(4-methylphenyl)-[4-[methyl(2,2,2-trifluoroethyl)amino]phenyl]methyl]-N-(2,2,2-trifluoroethyl)aniline |
|---|---|
| PubChem CID | 100990166 |
| Molecular Formula | C26H26F6N2 |
| Molecular Weight | 480.50 g/mol |
| Exact Mass | 480.20 |
| IUPAC Name | N-methyl-4-[(4-methylphenyl)-[4-[methyl(2,2,2-trifluoroethyl)amino]phenyl]methyl]-N-(2,2,2-trifluoroethyl)aniline |
| SMILES | Cc1ccc(C(c2ccc(N(C)CC(F)(F)F)cc2)c2ccc(N(C)CC(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C26H26F6N2/c1-18-4-6-19(7-5-18)24(20-8-12-22(13-9-20)33(2)16-25(27,28)29)21-10-14-23(15-11-21)34(3)17-26(30,31)32/h4-15,24H,16-17H2,1-3H3 |
| InChIKey | AYMDFZPAXVCNQJ-UHFFFAOYSA-N |
| XLogP | 7.17 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.50 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|