C10H15N — CID 3036494
N-ethyl-N,4-dimethylaniline (PubChem CID 3036494) has the molecular formula C10H15N and a molecular weight of 149.24 g/mol. Its IUPAC name is N-ethyl-N,4-dimethylaniline.
| Compound Name | N-ethyl-N,4-dimethylaniline |
|---|---|
| PubChem CID | 3036494 |
| Molecular Formula | C10H15N |
| Molecular Weight | 149.24 g/mol |
| Exact Mass | 149.12 |
| IUPAC Name | N-ethyl-N,4-dimethylaniline |
| SMILES | CCN(C)c1ccc(C)cc1 |
| InChI | InChI=1S/C10H15N/c1-4-11(3)10-7-5-9(2)6-8-10/h5-8H,4H2,1-3H3 |
| InChIKey | ZFFFSHWQGNCAIF-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 149.24 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|