C11H17N — CID 14671247
N,4-dimethyl-N-propylaniline (PubChem CID 14671247) has the molecular formula C11H17N and a molecular weight of 163.26 g/mol. Its IUPAC name is N,4-dimethyl-N-propylaniline.
| Compound Name | N,4-dimethyl-N-propylaniline |
|---|---|
| PubChem CID | 14671247 |
| Molecular Formula | C11H17N |
| Molecular Weight | 163.26 g/mol |
| Exact Mass | 163.14 |
| IUPAC Name | N,4-dimethyl-N-propylaniline |
| SMILES | CCCN(C)c1ccc(C)cc1 |
| InChI | InChI=1S/C11H17N/c1-4-9-12(3)11-7-5-10(2)6-8-11/h5-8H,4,9H2,1-3H3 |
| InChIKey | HNIRMWZQRJUUJN-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.26 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|