C12H17NO — CID 145026678
4-(N,4-dimethylanilino)butanal (PubChem CID 145026678) has the molecular formula C12H17NO and a molecular weight of 191.27 g/mol. Its IUPAC name is 4-(N,4-dimethylanilino)butanal.
| Compound Name | 4-(N,4-dimethylanilino)butanal |
|---|---|
| PubChem CID | 145026678 |
| Molecular Formula | C12H17NO |
| Molecular Weight | 191.27 g/mol |
| Exact Mass | 191.13 |
| IUPAC Name | 4-(N,4-dimethylanilino)butanal |
| SMILES | Cc1ccc(N(C)CCCC=O)cc1 |
| InChI | InChI=1S/C12H17NO/c1-11-5-7-12(8-6-11)13(2)9-3-4-10-14/h5-8,10H,3-4,9H2,1-2H3 |
| InChIKey | CEFAYWSUYMZQIP-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.27 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|