About ethene;hexanal;1,4-xylene
ethene;hexanal;1,4-xylene (PubChem CID 145294494) has the molecular formula C16H26O
and a molecular weight of 234.38 g/mol. Its IUPAC name is ethene;hexanal;1,4-xylene.
Molecular Properties
| Compound Name | ethene;hexanal;1,4-xylene |
| PubChem CID | 145294494 |
| Molecular Formula | C16H26O |
| Molecular Weight | 234.38 g/mol |
| Exact Mass | 234.20 |
| IUPAC Name | ethene;hexanal;1,4-xylene |
| SMILES | C=C.CCCCCC=O.Cc1ccc(C)cc1 |
| InChI | InChI=1S/C8H10.C6H12O.C2H4/c1-7-3-5-8(2)6-4-7;1-2-3-4-5-6-7;1-2/h3-6H,1-2H3;6H,2-5H2,1H3;1-2H2 |
| InChIKey | WXEZUNWOBWAODO-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.38 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze ethene;hexanal;1,4-xylene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethene;hexanal;1,4-xylene?
The IUPAC name of ethene;hexanal;1,4-xylene (CID 145294494) is ethene;hexanal;1,4-xylene.
What is the SMILES notation for ethene;hexanal;1,4-xylene?
The canonical SMILES for ethene;hexanal;1,4-xylene is C=C.CCCCCC=O.Cc1ccc(C)cc1.
What is the InChIKey of ethene;hexanal;1,4-xylene?
The InChIKey is WXEZUNWOBWAODO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10.C6H12O.C2H4/c1-7-3-5-8(2)6-4-7;1-2-3-4-5-6-7;1-2/h3-6H,1-2H3;6H,2-5H2,1H3;1-2H2.
What are the key properties of ethene;hexanal;1,4-xylene?
ethene;hexanal;1,4-xylene has a molecular weight of 234.38 g/mol, XLogP of 4.87, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethene;hexanal;1,4-xylene is sourced from PubChem (CID 145294494), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).