About formaldehyde;hexane;1,4-xylene
formaldehyde;hexane;1,4-xylene (PubChem CID 143308406) has the molecular formula C15H26O
and a molecular weight of 222.37 g/mol. Its IUPAC name is formaldehyde;hexane;1,4-xylene.
Molecular Properties
| Compound Name | formaldehyde;hexane;1,4-xylene |
| PubChem CID | 143308406 |
| Molecular Formula | C15H26O |
| Molecular Weight | 222.37 g/mol |
| Exact Mass | 222.20 |
| IUPAC Name | formaldehyde;hexane;1,4-xylene |
| SMILES | C=O.CCCCCC.Cc1ccc(C)cc1 |
| InChI | InChI=1S/C8H10.C6H14.CH2O/c1-7-3-5-8(2)6-4-7;1-3-5-6-4-2;1-2/h3-6H,1-2H3;3-6H2,1-2H3;1H2 |
| InChIKey | XQRRCLBQHMBGJE-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.37 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze formaldehyde;hexane;1,4-xylene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of formaldehyde;hexane;1,4-xylene?
The IUPAC name of formaldehyde;hexane;1,4-xylene (CID 143308406) is formaldehyde;hexane;1,4-xylene.
What is the SMILES notation for formaldehyde;hexane;1,4-xylene?
The canonical SMILES for formaldehyde;hexane;1,4-xylene is C=O.CCCCCC.Cc1ccc(C)cc1.
What is the InChIKey of formaldehyde;hexane;1,4-xylene?
The InChIKey is XQRRCLBQHMBGJE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10.C6H14.CH2O/c1-7-3-5-8(2)6-4-7;1-3-5-6-4-2;1-2/h3-6H,1-2H3;3-6H2,1-2H3;1H2.
What are the key properties of formaldehyde;hexane;1,4-xylene?
formaldehyde;hexane;1,4-xylene has a molecular weight of 222.37 g/mol, XLogP of 4.71, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for formaldehyde;hexane;1,4-xylene is sourced from PubChem (CID 143308406), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).